C27H27F3N2O2S — CID 93305441
(2E)-2-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethylidene]-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-3-one (PubChem CID 93305441) has the molecular formula C27H27F3N2O2S and a molecular weight of 500.59 g/mol. Its IUPAC name is (2E)-2-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethylidene]-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethylidene]-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 93305441 |
| Molecular Formula | C27H27F3N2O2S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (2E)-2-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethylidene]-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-3-one |
| SMILES | O=C1/C(=C\C(=O)N2CCC[C@H]3CCCC[C@@H]32)Sc2ccccc2N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F3N2O2S/c28-27(29,30)20-10-5-7-18(15-20)17-32-22-12-3-4-13-23(22)35-24(26(32)34)16-25(33)31-14-6-9-19-8-1-2-11-21(19)31/h3-5,7,10,12-13,15-16,19,21H,1-2,6,8-9,11,14,17H2/b24-16+/t19-,21+/m1/s1 |
| InChIKey | FHCKFLBIWSAMNO-KLLNBMELSA-N |
| XLogP | 6.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|