C19H24F3NO3S — CID 55703453
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]ethanone (PubChem CID 55703453) has the molecular formula C19H24F3NO3S and a molecular weight of 403.47 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]ethanone |
|---|---|
| PubChem CID | 55703453 |
| Molecular Formula | C19H24F3NO3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]ethanone |
| SMILES | O=C(CS(=O)(=O)Cc1cccc(C(F)(F)F)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C19H24F3NO3S/c20-19(21,22)16-8-3-5-14(11-16)12-27(25,26)13-18(24)23-10-4-7-15-6-1-2-9-17(15)23/h3,5,8,11,15,17H,1-2,4,6-7,9-10,12-13H2 |
| InChIKey | CJOCYEJBKJNODI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |