C17H21F3N2O4S — CID 56548815
N-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 56548815) has the molecular formula C17H21F3N2O4S and a molecular weight of 406.43 g/mol. Its IUPAC name is N-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 56548815 |
| Molecular Formula | C17H21F3N2O4S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1cccc(C(F)(F)F)c1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C17H21F3N2O4S/c18-17(19,20)12-4-3-5-13(10-12)27(24,25)21-11-16(23)22-8-9-26-15-7-2-1-6-14(15)22/h3-5,10,14-15,21H,1-2,6-9,11H2 |
| InChIKey | KFBULCPFPNDLLF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |