C17H22N2O3 — CID 94823341
N-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]benzamide (PubChem CID 94823341) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 94823341 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCO[C@@H]2CCCC[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O3/c20-16(12-18-17(21)13-6-2-1-3-7-13)19-10-11-22-15-9-5-4-8-14(15)19/h1-3,6-7,14-15H,4-5,8-12H2,(H,18,21)/t14-,15-/m1/s1 |
| InChIKey | NMEYJGWYPYNWSE-HUUCEWRRSA-N |
| XLogP | 1.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |