C19H25N3O4 — CID 110807089
N-[2-oxo-2-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]ethyl]benzamide (PubChem CID 110807089) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 110807089 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[2-oxo-2-[4-(oxolane-2-carbonyl)-1,4-diazepan-1-yl]ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCCN(C(=O)C2CCCO2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O4/c23-17(14-20-18(24)15-6-2-1-3-7-15)21-9-5-10-22(12-11-21)19(25)16-8-4-13-26-16/h1-3,6-7,16H,4-5,8-14H2,(H,20,24) |
| InChIKey | RZTQRQYUOWNBNY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |