C19H28N4O3 — CID 110813314
4-(2-benzamidoacetyl)-N-tert-butyl-1,4-diazepane-1-carboxamide (PubChem CID 110813314) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(2-benzamidoacetyl)-N-tert-butyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2-benzamidoacetyl)-N-tert-butyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813314 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 4-(2-benzamidoacetyl)-N-tert-butyl-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(C(=O)CNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N4O3/c1-19(2,3)21-18(26)23-11-7-10-22(12-13-23)16(24)14-20-17(25)15-8-5-4-6-9-15/h4-6,8-9H,7,10-14H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | LZKRBGMRFQWHJG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |