C16H23N3O4S — CID 110810039
N-[2-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-oxoethyl]benzamide (PubChem CID 110810039) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[2-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-oxoethyl]benzamide.
| Compound Name | N-[2-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110810039 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[2-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-oxoethyl]benzamide |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)CNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23N3O4S/c1-2-24(22,23)19-10-6-9-18(11-12-19)15(20)13-17-16(21)14-7-4-3-5-8-14/h3-5,7-8H,2,6,9-13H2,1H3,(H,17,21) |
| InChIKey | RXCAUKLIRSPERD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |