C19H25NO3 — CID 135103785
1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-5-phenylpentane-1,5-dione (PubChem CID 135103785) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-5-phenylpentane-1,5-dione.
| Compound Name | 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-5-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 135103785 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-5-phenylpentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCO[C@@H]2CCCC[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c21-17(15-7-2-1-3-8-15)10-6-12-19(22)20-13-14-23-18-11-5-4-9-16(18)20/h1-3,7-8,16,18H,4-6,9-14H2/t16-,18-/m1/s1 |
| InChIKey | ZOJYMWBYFJVVIP-SJLPKXTDSA-N |
| XLogP | 3.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |