C16H20F3NOS — CID 112768938
1-(2-methylpiperidin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethanone (PubChem CID 112768938) has the molecular formula C16H20F3NOS and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-(2-methylpiperidin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethanone.
| Compound Name | 1-(2-methylpiperidin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethanone |
|---|---|
| PubChem CID | 112768938 |
| Molecular Formula | C16H20F3NOS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(2-methylpiperidin-1-yl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethanone |
| SMILES | CC1CCCCN1C(=O)CSCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NOS/c1-12-5-2-3-8-20(12)15(21)11-22-10-13-6-4-7-14(9-13)16(17,18)19/h4,6-7,9,12H,2-3,5,8,10-11H2,1H3 |
| InChIKey | WXIYGEQSWNHBKL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |