C21H17N3O5S — CID 11611563
N-benzyl-2-[7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 11611563) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is N-benzyl-2-[7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-benzyl-2-[7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 11611563 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-benzyl-2-[7-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)COc2cc(/C=C3\SC(=O)NC3=O)ccc21)NCc1ccccc1 |
| InChI | InChI=1S/C21H17N3O5S/c25-18(22-10-13-4-2-1-3-5-13)11-24-15-7-6-14(8-16(15)29-12-19(24)26)9-17-20(27)23-21(28)30-17/h1-9H,10-12H2,(H,22,25)(H,23,27,28)/b17-9- |
| InChIKey | FWBQPGPYLPSGNY-MFOYZWKCSA-N |
| XLogP | 2.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|