C13H10N2O4S — CID 10334391
(5Z)-5-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10334391) has the molecular formula C13H10N2O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is (5Z)-5-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10334391 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (5Z)-5-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)COc2ccc(/C=C3\SC(=O)NC3=O)cc21 |
| InChI | InChI=1S/C13H10N2O4S/c1-15-8-4-7(2-3-9(8)19-6-11(15)16)5-10-12(17)14-13(18)20-10/h2-5H,6H2,1H3,(H,14,17,18)/b10-5- |
| InChIKey | RTCRUMNIQBEDBB-YHYXMXQVSA-N |
| XLogP | 1.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|