C30H33N3O4S — CID 87822303
5-[[4-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87822303) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is 5-[[4-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87822303 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 5-[[4-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc3c(c2)N(Cc2ccc(CN4CCC5(CCCCC5)CC4)cc2)C(=O)CO3)S1 |
| InChI | InChI=1S/C30H33N3O4S/c34-27-20-37-25-9-8-23(17-26-28(35)31-29(36)38-26)16-24(25)33(27)19-22-6-4-21(5-7-22)18-32-14-12-30(13-15-32)10-2-1-3-11-30/h4-9,16-17H,1-3,10-15,18-20H2,(H,31,35,36) |
| InChIKey | KRAQWSKSLBVCAS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|