C20H13F3N2O6S3 — CID 90967440
[3-[[3-oxo-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-4-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 90967440) has the molecular formula C20H13F3N2O6S3 and a molecular weight of 530.53 g/mol. Its IUPAC name is [3-[[3-oxo-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-4-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[[3-oxo-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-4-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90967440 |
| Molecular Formula | C20H13F3N2O6S3 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | [3-[[3-oxo-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-4-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C1NC(=S)SC1=Cc1ccc2c(c1)N(Cc1cccc(OS(=O)(=O)C(F)(F)F)c1)C(=O)CO2 |
| InChI | InChI=1S/C20H13F3N2O6S3/c21-20(22,23)34(28,29)31-13-3-1-2-12(6-13)9-25-14-7-11(4-5-15(14)30-10-17(25)26)8-16-18(27)24-19(32)33-16/h1-8H,9-10H2,(H,24,27,32) |
| InChIKey | LGNMNKJIMQWQNR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|