C22H20N2O6S2 — CID 18452383
(5Z)-5-[[3-oxo-4-[(3-propan-2-ylsulfonylphenyl)methyl]-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 18452383) has the molecular formula C22H20N2O6S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is (5Z)-5-[[3-oxo-4-[(3-propan-2-ylsulfonylphenyl)methyl]-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-oxo-4-[(3-propan-2-ylsulfonylphenyl)methyl]-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18452383 |
| Molecular Formula | C22H20N2O6S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (5Z)-5-[[3-oxo-4-[(3-propan-2-ylsulfonylphenyl)methyl]-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)S(=O)(=O)c1cccc(CN2C(=O)COc3ccc(/C=C4\SC(=O)NC4=O)cc32)c1 |
| InChI | InChI=1S/C22H20N2O6S2/c1-13(2)32(28,29)16-5-3-4-15(8-16)11-24-17-9-14(6-7-18(17)30-12-20(24)25)10-19-21(26)23-22(27)31-19/h3-10,13H,11-12H2,1-2H3,(H,23,26,27)/b19-10- |
| InChIKey | ZYIPVXFDXIQZMF-GRSHGNNSSA-N |
| XLogP | 3.12 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|