C18H11Cl2N3O4S — CID 18452385
(5Z)-5-[[4-[(2,6-dichloro-4-pyridinyl)methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 18452385) has the molecular formula C18H11Cl2N3O4S and a molecular weight of 436.28 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,6-dichloro-4-pyridinyl)methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(2,6-dichloro-4-pyridinyl)methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18452385 |
| Molecular Formula | C18H11Cl2N3O4S |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | (5Z)-5-[[4-[(2,6-dichloro-4-pyridinyl)methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc3c(c2)N(Cc2cc(Cl)nc(Cl)c2)C(=O)CO3)S1 |
| InChI | InChI=1S/C18H11Cl2N3O4S/c19-14-5-10(6-15(20)21-14)7-23-11-3-9(1-2-12(11)27-8-16(23)24)4-13-17(25)22-18(26)28-13/h1-6H,7-8H2,(H,22,25,26)/b13-4- |
| InChIKey | MUKONRROEDBJIR-PQMHYQBVSA-N |
| XLogP | 3.64 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|