C19H14N2O4S2 — CID 87820208
6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-phenylmethoxy-1,4-benzoxazin-3-one (PubChem CID 87820208) has the molecular formula C19H14N2O4S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-phenylmethoxy-1,4-benzoxazin-3-one.
| Compound Name | 6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-phenylmethoxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 87820208 |
| Molecular Formula | C19H14N2O4S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-phenylmethoxy-1,4-benzoxazin-3-one |
| SMILES | O=C1NC(=S)SC1=Cc1ccc2c(c1)N(OCc1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C19H14N2O4S2/c22-17-11-24-15-7-6-13(9-16-18(23)20-19(26)27-16)8-14(15)21(17)25-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,23,26) |
| InChIKey | JLAAYVYIGPXPLS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|