C12H8N2O4S — CID 87966357
5-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87966357) has the molecular formula C12H8N2O4S and a molecular weight of 276.27 g/mol. Its IUPAC name is 5-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87966357 |
| Molecular Formula | C12H8N2O4S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 5-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1COc2ccc(C=C3SC(=O)NC3=O)cc2N1 |
| InChI | InChI=1S/C12H8N2O4S/c15-10-5-18-8-2-1-6(3-7(8)13-10)4-9-11(16)14-12(17)19-9/h1-4H,5H2,(H,13,15)(H,14,16,17) |
| InChIKey | PLRJLGTXHMMTDV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|