C13H11NO3S — CID 10264639
(5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10264639) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is (5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10264639 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (5E)-5-[(2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1Cc2ccc(/C=C3/SC(=O)NC3=O)cc2O1 |
| InChI | InChI=1S/C13H11NO3S/c1-7-4-9-3-2-8(5-10(9)17-7)6-11-12(15)14-13(16)18-11/h2-3,5-7H,4H2,1H3,(H,14,15,16)/b11-6+ |
| InChIKey | MZYIECBCKATUAA-IZZDOVSWSA-N |
| XLogP | 2.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|