C14H18N2O2P2 — CID 76609180
6-[[1-(diphosphanyl)piperidin-3-ylidene]methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 76609180) has the molecular formula C14H18N2O2P2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 6-[[1-(diphosphanyl)piperidin-3-ylidene]methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[[1-(diphosphanyl)piperidin-3-ylidene]methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 76609180 |
| Molecular Formula | C14H18N2O2P2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 6-[[1-(diphosphanyl)piperidin-3-ylidene]methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C=C3CCCN(PP)C3)cc2N1 |
| InChI | InChI=1S/C14H18N2O2P2/c17-14-9-18-13-4-3-10(7-12(13)15-14)6-11-2-1-5-16(8-11)20-19/h3-4,6-7,20H,1-2,5,8-9,19H2,(H,15,17) |
| InChIKey | PNJHKQWYSGPKDR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|