C18H11F6NO2 — CID 76611324
6-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-4H-1,4-benzoxazin-3-one (PubChem CID 76611324) has the molecular formula C18H11F6NO2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 6-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 76611324 |
| Molecular Formula | C18H11F6NO2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 6-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C=Cc3ccc(C(F)(F)F)cc3C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C18H11F6NO2/c19-17(20,21)12-5-4-11(13(8-12)18(22,23)24)3-1-10-2-6-15-14(7-10)25-16(26)9-27-15/h1-8H,9H2,(H,25,26) |
| InChIKey | IRXIMIUFYNMPPZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|