C17H13F3N2O4S — CID 68978797
2-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 68978797) has the molecular formula C17H13F3N2O4S and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 68978797 |
| Molecular Formula | C17H13F3N2O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(F)(F)F)cc1C=Cc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C17H13F3N2O4S/c18-17(19,20)12-4-6-15(27(21,24)25)11(8-12)3-1-10-2-5-14-13(7-10)22-16(23)9-26-14/h1-8H,9H2,(H,22,23)(H2,21,24,25) |
| InChIKey | DWZFZVIRYZYUCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|