C14H11N3O3 — CID 100638920
6-[(E)-2-(6-oxo-1H-pyrimidin-2-yl)ethenyl]-4H-1,4-benzoxazin-3-one (PubChem CID 100638920) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-[(E)-2-(6-oxo-1H-pyrimidin-2-yl)ethenyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(E)-2-(6-oxo-1H-pyrimidin-2-yl)ethenyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 100638920 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-[(E)-2-(6-oxo-1H-pyrimidin-2-yl)ethenyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(/C=C/c3nccc(=O)[nH]3)cc2N1 |
| InChI | InChI=1S/C14H11N3O3/c18-13-5-6-15-12(17-13)4-2-9-1-3-11-10(7-9)16-14(19)8-20-11/h1-7H,8H2,(H,16,19)(H,15,17,18)/b4-2+ |
| InChIKey | MVGVQPYLJIJBRO-DUXPYHPUSA-N |
| XLogP | 1.27 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |