C15H12N2O2 — CID 86730947
7-[(E)-2-phenylethenyl]-1H-pyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 86730947) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 7-[(E)-2-phenylethenyl]-1H-pyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | 7-[(E)-2-phenylethenyl]-1H-pyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 86730947 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 7-[(E)-2-phenylethenyl]-1H-pyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | O=C1COc2cnc(/C=C/c3ccccc3)cc2N1 |
| InChI | InChI=1S/C15H12N2O2/c18-15-10-19-14-9-16-12(8-13(14)17-15)7-6-11-4-2-1-3-5-11/h1-9H,10H2,(H,17,18)/b7-6+ |
| InChIKey | ZJYDPBTZUMDHGQ-VOTSOKGWSA-N |
| XLogP | 2.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |