C12H15NO2S — CID 116866482
6-(2-methyl-1-sulfanylpropan-2-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 116866482) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 6-(2-methyl-1-sulfanylpropan-2-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-methyl-1-sulfanylpropan-2-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116866482 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-(2-methyl-1-sulfanylpropan-2-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(CS)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H15NO2S/c1-12(2,7-16)8-3-4-10-9(5-8)13-11(14)6-15-10/h3-5,16H,6-7H2,1-2H3,(H,13,14) |
| InChIKey | OZCRCZMHEAGXHQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|