C16H13N2O3S2+ — CID 58107824
[5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-methyl-oxoazanium (PubChem CID 58107824) has the molecular formula C16H13N2O3S2+ and a molecular weight of 345.43 g/mol. Its IUPAC name is [5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-methyl-oxoazanium.
| Compound Name | [5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 58107824 |
| Molecular Formula | C16H13N2O3S2+ |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [5-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]-2-methylphenyl]-methyl-oxoazanium |
| SMILES | Cc1ccc(-c2ccc(C=C3SC(=O)NC3=O)s2)cc1[N+](C)=O |
| InChI | InChI=1S/C16H12N2O3S2/c1-9-3-4-10(7-12(9)18(2)21)13-6-5-11(22-13)8-14-15(19)17-16(20)23-14/h3-8H,1-2H3/p+1 |
| InChIKey | YKENYFURXRFGNI-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 66.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|