C17H13NO4S2 — CID 58587045
methyl 5-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]-2-methylbenzoate (PubChem CID 58587045) has the molecular formula C17H13NO4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 5-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]-2-methylbenzoate.
| Compound Name | methyl 5-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 58587045 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | methyl 5-[5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cc(-c2csc(/C=C3/SC(=O)NC3=O)c2)ccc1C |
| InChI | InChI=1S/C17H13NO4S2/c1-9-3-4-10(6-13(9)16(20)22-2)11-5-12(23-8-11)7-14-15(19)18-17(21)24-14/h3-8H,1-2H3,(H,18,19,21)/b14-7+ |
| InChIKey | IBTDSMDZJUNLHK-VGOFMYFVSA-N |
| XLogP | 3.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|