C14H8FN3O2S — CID 90714732
5-[(4-fluoro-2-pyrazin-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 90714732) has the molecular formula C14H8FN3O2S and a molecular weight of 301.30 g/mol. Its IUPAC name is 5-[(4-fluoro-2-pyrazin-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-fluoro-2-pyrazin-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90714732 |
| Molecular Formula | C14H8FN3O2S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 5-[(4-fluoro-2-pyrazin-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(F)cc2-c2cnccn2)S1 |
| InChI | InChI=1S/C14H8FN3O2S/c15-9-2-1-8(5-12-13(19)18-14(20)21-12)10(6-9)11-7-16-3-4-17-11/h1-7H,(H,18,19,20) |
| InChIKey | YBIKYIAKVZHGMI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|