C17H13N3O3S — CID 86758834
4-amino-N-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzamide (PubChem CID 86758834) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 4-amino-N-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 86758834 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-amino-N-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2cccc(C=C3SC(=O)NC3=O)c2)cc1 |
| InChI | InChI=1S/C17H13N3O3S/c18-12-6-4-11(5-7-12)15(21)19-13-3-1-2-10(8-13)9-14-16(22)20-17(23)24-14/h1-9H,18H2,(H,19,21)(H,20,22,23) |
| InChIKey | JEOACSWNBNIBMD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|