C11H7BrN2O3S — CID 18809143
(2Z)-N-(3-bromophenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide (PubChem CID 18809143) has the molecular formula C11H7BrN2O3S and a molecular weight of 327.16 g/mol. Its IUPAC name is (2Z)-N-(3-bromophenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide.
| Compound Name | (2Z)-N-(3-bromophenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
|---|---|
| PubChem CID | 18809143 |
| Molecular Formula | C11H7BrN2O3S |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | (2Z)-N-(3-bromophenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
| SMILES | O=C(/C=C1\SC(=O)NC1=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C11H7BrN2O3S/c12-6-2-1-3-7(4-6)13-9(15)5-8-10(16)14-11(17)18-8/h1-5H,(H,13,15)(H,14,16,17)/b8-5- |
| InChIKey | OTCUEVJUGIAPIH-YVMONPNESA-N |
| XLogP | 2.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|