C12H9ClN2O3S — CID 18809139
(2Z)-N-(3-chloro-4-methylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide (PubChem CID 18809139) has the molecular formula C12H9ClN2O3S and a molecular weight of 296.74 g/mol. Its IUPAC name is (2Z)-N-(3-chloro-4-methylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide.
| Compound Name | (2Z)-N-(3-chloro-4-methylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
|---|---|
| PubChem CID | 18809139 |
| Molecular Formula | C12H9ClN2O3S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | (2Z)-N-(3-chloro-4-methylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
| SMILES | Cc1ccc(NC(=O)/C=C2\SC(=O)NC2=O)cc1Cl |
| InChI | InChI=1S/C12H9ClN2O3S/c1-6-2-3-7(4-8(6)13)14-10(16)5-9-11(17)15-12(18)19-9/h2-5H,1H3,(H,14,16)(H,15,17,18)/b9-5- |
| InChIKey | VYDWHXIWDOEAID-UITAMQMPSA-N |
| XLogP | 2.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|