About [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate
[4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate (PubChem CID 1330053) has the molecular formula C18H15BrFNO3S
and a molecular weight of 424.29 g/mol. Its IUPAC name is [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate |
| PubChem CID | 1330053 |
| Molecular Formula | C18H15BrFNO3S |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate |
| SMILES | O=C(Oc1ccc(Br)cc1C(=S)N1CCOCC1)c1ccccc1F |
| InChI | InChI=1S/C18H15BrFNO3S/c19-12-5-6-16(24-18(22)13-3-1-2-4-15(13)20)14(11-12)17(25)21-7-9-23-10-8-21/h1-6,11H,7-10H2 |
| InChIKey | DQFDEAPANOMHIL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate?
The IUPAC name of [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate (CID 1330053) is [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate.
What is the SMILES notation for [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate?
The canonical SMILES for [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate is O=C(Oc1ccc(Br)cc1C(=S)N1CCOCC1)c1ccccc1F.
What is the InChIKey of [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate?
The InChIKey is DQFDEAPANOMHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrFNO3S/c19-12-5-6-16(24-18(22)13-3-1-2-4-15(13)20)14(11-12)17(25)21-7-9-23-10-8-21/h1-6,11H,7-10H2.
What are the key properties of [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate?
[4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate has a molecular weight of 424.29 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-2-(morpholine-4-carbothioyl)phenyl] 2-fluorobenzoate is sourced from PubChem (CID 1330053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).