C17H22ClNO2S — CID 3969715
(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione (PubChem CID 3969715) has the molecular formula C17H22ClNO2S and a molecular weight of 339.89 g/mol. Its IUPAC name is (3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione.
| Compound Name | (3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione |
|---|---|
| PubChem CID | 3969715 |
| Molecular Formula | C17H22ClNO2S |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione |
| SMILES | C=CCOc1c(Cl)cc(C(=S)N2CCCCC2)cc1OCC |
| InChI | InChI=1S/C17H22ClNO2S/c1-3-10-21-16-14(18)11-13(12-15(16)20-4-2)17(22)19-8-6-5-7-9-19/h3,11-12H,1,4-10H2,2H3 |
| InChIKey | XQNPBWAAHJVAPZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|