C15H18ClNOS — CID 5001144
(3-chloro-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione (PubChem CID 5001144) has the molecular formula C15H18ClNOS and a molecular weight of 295.84 g/mol. Its IUPAC name is (3-chloro-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione.
| Compound Name | (3-chloro-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione |
|---|---|
| PubChem CID | 5001144 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (3-chloro-4-prop-2-enoxyphenyl)-piperidin-1-ylmethanethione |
| SMILES | C=CCOc1ccc(C(=S)N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C15H18ClNOS/c1-2-10-18-14-7-6-12(11-13(14)16)15(19)17-8-4-3-5-9-17/h2,6-7,11H,1,3-5,8-10H2 |
| InChIKey | QAJMRZVJXRVXJM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|