C22H26FNO2S — CID 4664804
[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione (PubChem CID 4664804) has the molecular formula C22H26FNO2S and a molecular weight of 387.52 g/mol. Its IUPAC name is [3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione.
| Compound Name | [3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
|---|---|
| PubChem CID | 4664804 |
| Molecular Formula | C22H26FNO2S |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
| SMILES | CCOc1cc(C(=S)N2CCC(C)CC2)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C22H26FNO2S/c1-3-25-21-14-18(22(27)24-11-9-16(2)10-12-24)7-8-20(21)26-15-17-5-4-6-19(23)13-17/h4-8,13-14,16H,3,9-12,15H2,1-2H3 |
| InChIKey | RTHYFWFETQIRSR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|