C24H33N3O5S — CID 16881049
N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-3,4-diethoxybenzamide (PubChem CID 16881049) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 16881049 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCCS(=O)(=O)N2CCN(Cc3ccccc3)CC2)cc1OCC |
| InChI | InChI=1S/C24H33N3O5S/c1-3-31-22-11-10-21(18-23(22)32-4-2)24(28)25-12-17-33(29,30)27-15-13-26(14-16-27)19-20-8-6-5-7-9-20/h5-11,18H,3-4,12-17,19H2,1-2H3,(H,25,28) |
| InChIKey | SVLZXSFDDNEJJD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |