C21H25Cl2N3O4S — CID 16881077
N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 16881077) has the molecular formula C21H25Cl2N3O4S and a molecular weight of 486.42 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 16881077 |
| Molecular Formula | C21H25Cl2N3O4S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCS(=O)(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H25Cl2N3O4S/c22-18-6-7-20(19(23)14-18)30-16-21(27)24-8-13-31(28,29)26-11-9-25(10-12-26)15-17-4-2-1-3-5-17/h1-7,14H,8-13,15-16H2,(H,24,27) |
| InChIKey | VVFLOWBADHARDR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |