C20H23F2N3O3S — CID 42590040
N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2,6-difluorobenzamide (PubChem CID 42590040) has the molecular formula C20H23F2N3O3S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 42590040 |
| Molecular Formula | C20H23F2N3O3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)sulfonylethyl]-2,6-difluorobenzamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(Cc2ccccc2)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H23F2N3O3S/c21-17-7-4-8-18(22)19(17)20(26)23-9-14-29(27,28)25-12-10-24(11-13-25)15-16-5-2-1-3-6-16/h1-8H,9-15H2,(H,23,26) |
| InChIKey | HBSVSGNFMUCOJY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |