C19H18BrClO3 — CID 91686046
ethyl (E)-3-[3-bromo-5-chloro-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 91686046) has the molecular formula C19H18BrClO3 and a molecular weight of 409.71 g/mol. Its IUPAC name is ethyl (E)-3-[3-bromo-5-chloro-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-bromo-5-chloro-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91686046 |
| Molecular Formula | C19H18BrClO3 |
| Molecular Weight | 409.71 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | ethyl (E)-3-[3-bromo-5-chloro-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(Cl)c(OCc2ccccc2C)c(Br)c1 |
| InChI | InChI=1S/C19H18BrClO3/c1-3-23-18(22)9-8-14-10-16(20)19(17(21)11-14)24-12-15-7-5-4-6-13(15)2/h4-11H,3,12H2,1-2H3/b9-8+ |
| InChIKey | ROODUCIIXSVNJA-CMDGGOBGSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|