C20H18Cl2N2O2S — CID 1312195
5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1312195) has the molecular formula C20H18Cl2N2O2S and a molecular weight of 421.35 g/mol. Its IUPAC name is 5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1312195 |
| Molecular Formula | C20H18Cl2N2O2S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)C(=Cc2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)N(C)C1=S |
| InChI | InChI=1S/C20H18Cl2N2O2S/c1-3-24-19(25)18(23(2)20(24)27)11-13-4-7-15(8-5-13)26-12-14-6-9-16(21)17(22)10-14/h4-11H,3,12H2,1-2H3 |
| InChIKey | NPDUQFXZTSSKGP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|