C31H20Cl6N2O3 — CID 122193477
(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-bis[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 122193477) has the molecular formula C31H20Cl6N2O3 and a molecular weight of 681.23 g/mol. Its IUPAC name is (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-bis[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-bis[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 122193477 |
| Molecular Formula | C31H20Cl6N2O3 |
| Molecular Weight | 681.23 g/mol |
| Exact Mass | 677.96 |
| IUPAC Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-bis[(3,4-dichlorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1/C(=C\c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)N(Cc2ccc(Cl)c(Cl)c2)C(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H20Cl6N2O3/c32-23-8-3-19(11-26(23)35)15-38-29(30(40)39(31(38)41)16-20-4-9-24(33)27(36)12-20)14-18-1-6-22(7-2-18)42-17-21-5-10-25(34)28(37)13-21/h1-14H,15-17H2/b29-14+ |
| InChIKey | KNAMBPKPGLFZRG-IPPBACCNSA-N |
| XLogP | 10.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.23 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|