C23H20Cl2N2O5S — CID 124665694
(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124665694) has the molecular formula C23H20Cl2N2O5S and a molecular weight of 507.40 g/mol. Its IUPAC name is (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124665694 |
| Molecular Formula | C23H20Cl2N2O5S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | (5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C23H20Cl2N2O5S/c24-18-6-3-16(11-19(18)25)14-32-17-4-1-15(2-5-17)12-20-22(29)27(23(30)33-20)13-21(28)26-7-9-31-10-8-26/h1-6,11-12H,7-10,13-14H2/b20-12+ |
| InChIKey | LCIKBCUNXOAQQU-UDWIEESQSA-N |
| XLogP | 4.47 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|