C21H18N2O7 — CID 122193542
2-[(4E)-3-benzyl-4-[[4-(carboxymethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 122193542) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-[(4E)-3-benzyl-4-[[4-(carboxymethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4E)-3-benzyl-4-[[4-(carboxymethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 122193542 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[(4E)-3-benzyl-4-[[4-(carboxymethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2\C(=O)N(CC(=O)O)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O7/c24-18(25)12-23-20(28)17(22(21(23)29)11-15-4-2-1-3-5-15)10-14-6-8-16(9-7-14)30-13-19(26)27/h1-10H,11-13H2,(H,24,25)(H,26,27)/b17-10+ |
| InChIKey | KUKWGFKTNOQUDR-LICLKQGHSA-N |
| XLogP | 2.04 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|