C18H12ClNO5S — CID 27411394
2-[4-[(E)-[3-(2-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 27411394) has the molecular formula C18H12ClNO5S and a molecular weight of 389.82 g/mol. Its IUPAC name is 2-[4-[(E)-[3-(2-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[3-(2-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 27411394 |
| Molecular Formula | C18H12ClNO5S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-[4-[(E)-[3-(2-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2/SC(=O)N(c3ccccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C18H12ClNO5S/c19-13-3-1-2-4-14(13)20-17(23)15(26-18(20)24)9-11-5-7-12(8-6-11)25-10-16(21)22/h1-9H,10H2,(H,21,22)/b15-9+ |
| InChIKey | TWJAFDQLAIHVOJ-OQLLNIDSSA-N |
| XLogP | 4.04 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|