C19H15BrCl2N2O2S — CID 1003882
(5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1003882) has the molecular formula C19H15BrCl2N2O2S and a molecular weight of 486.22 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1003882 |
| Molecular Formula | C19H15BrCl2N2O2S |
| Molecular Weight | 486.22 g/mol |
| Exact Mass | 483.94 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2cc(Br)ccc2OCc2ccc(Cl)c(Cl)c2)N(C)C1=S |
| InChI | InChI=1S/C19H15BrCl2N2O2S/c1-23-16(18(25)24(2)19(23)27)9-12-8-13(20)4-6-17(12)26-10-11-3-5-14(21)15(22)7-11/h3-9H,10H2,1-2H3/b16-9+ |
| InChIKey | GNHSKRNRMSPFGS-CXUHLZMHSA-N |
| XLogP | 5.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.22 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|