C25H27BrN2O2S — CID 126097151
(5Z)-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126097151) has the molecular formula C25H27BrN2O2S and a molecular weight of 499.47 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126097151 |
| Molecular Formula | C25H27BrN2O2S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccc(COc2ccc(Br)cc2/C=C2/C(=O)N(C3CCCCC3)C(=S)N2C)cc1 |
| InChI | InChI=1S/C25H27BrN2O2S/c1-17-8-10-18(11-9-17)16-30-23-13-12-20(26)14-19(23)15-22-24(29)28(25(31)27(22)2)21-6-4-3-5-7-21/h8-15,21H,3-7,16H2,1-2H3/b22-15- |
| InChIKey | OQEUNFRXGMLYLW-JCMHNJIXSA-N |
| XLogP | 6.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|