C28H27BrN2O2S — CID 126086070
(5Z)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126086070) has the molecular formula C28H27BrN2O2S and a molecular weight of 535.51 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126086070 |
| Molecular Formula | C28H27BrN2O2S |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(C2CCCCC2)C(=O)/C1=C/c1ccc(OCc2ccc3ccccc3c2)c(Br)c1 |
| InChI | InChI=1S/C28H27BrN2O2S/c1-30-25(27(32)31(28(30)34)23-9-3-2-4-10-23)17-19-12-14-26(24(29)16-19)33-18-20-11-13-21-7-5-6-8-22(21)15-20/h5-8,11-17,23H,2-4,9-10,18H2,1H3/b25-17- |
| InChIKey | LOTDNVPNIKPKNW-UQQQWYQISA-N |
| XLogP | 6.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|