C19H15ClN2O4S — CID 1344995
4-[[2-chloro-4-[(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 1344995) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-4-[(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 1344995 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 4-[[2-chloro-4-[(1-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | CN1C(=O)C(=Cc2ccc(OCc3ccc(C(=O)O)cc3)c(Cl)c2)NC1=S |
| InChI | InChI=1S/C19H15ClN2O4S/c1-22-17(23)15(21-19(22)27)9-12-4-7-16(14(20)8-12)26-10-11-2-5-13(6-3-11)18(24)25/h2-9H,10H2,1H3,(H,21,27)(H,24,25) |
| InChIKey | WBGCEFSMDLRXAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|