C23H24N2O6 — CID 126261892
4-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126261892) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126261892 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCCN1C(=O)N/C(=C/c2ccc(OCc3ccc(C(=O)O)cc3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C23H24N2O6/c1-3-11-25-21(26)18(24-23(25)29)12-16-7-10-19(20(13-16)30-4-2)31-14-15-5-8-17(9-6-15)22(27)28/h5-10,12-13H,3-4,11,14H2,1-2H3,(H,24,29)(H,27,28)/b18-12+ |
| InChIKey | ZMBDOCPYVTWWLG-LDADJPATSA-N |
| XLogP | 3.67 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|