C27H23BrN2O6 — CID 126257170
4-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126257170) has the molecular formula C27H23BrN2O6 and a molecular weight of 551.39 g/mol. Its IUPAC name is 4-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126257170 |
| Molecular Formula | C27H23BrN2O6 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 4-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H23BrN2O6/c1-2-35-23-14-19(12-21(28)24(23)36-16-18-8-10-20(11-9-18)26(32)33)13-22-25(31)30(27(34)29-22)15-17-6-4-3-5-7-17/h3-14H,2,15-16H2,1H3,(H,29,34)(H,32,33)/b22-13+ |
| InChIKey | ZGNDGYFINCLVNQ-LPYMAVHISA-N |
| XLogP | 5.22 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|