C28H25BrN2O6 — CID 126236639
3-[[2-bromo-6-ethoxy-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126236639) has the molecular formula C28H25BrN2O6 and a molecular weight of 565.42 g/mol. Its IUPAC name is 3-[[2-bromo-6-ethoxy-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-6-ethoxy-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126236639 |
| Molecular Formula | C28H25BrN2O6 |
| Molecular Weight | 565.42 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 3-[[2-bromo-6-ethoxy-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(Cc3ccc(C)cc3)C2=O)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H25BrN2O6/c1-3-36-24-14-20(12-22(29)25(24)37-16-19-5-4-6-21(11-19)27(33)34)13-23-26(32)31(28(35)30-23)15-18-9-7-17(2)8-10-18/h4-14H,3,15-16H2,1-2H3,(H,30,35)(H,33,34)/b23-13+ |
| InChIKey | DIAASFRBSWKEQL-YDZHTSKRSA-N |
| XLogP | 5.53 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|